C21H24ClN3O3S — CID 43067431
[2-(4-chlorophenyl)pyrrolidin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 43067431) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is [2-(4-chlorophenyl)pyrrolidin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 43067431 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccnc2)CC1)N1CCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O3S/c22-18-7-5-16(6-8-18)20-4-2-12-25(20)21(26)17-9-13-24(14-10-17)29(27,28)19-3-1-11-23-15-19/h1,3,5-8,11,15,17,20H,2,4,9-10,12-14H2 |
| InChIKey | ZXYRSXGGLYMEDW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |