C22H27ClN4O — CID 126769241
[2-(4-chlorophenyl)azepan-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone (PubChem CID 126769241) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is [2-(4-chlorophenyl)azepan-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone.
| Compound Name | [2-(4-chlorophenyl)azepan-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 126769241 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-(4-chlorophenyl)azepan-1-yl]-(1-pyrazin-2-ylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(c2cnccn2)CC1)N1CCCCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN4O/c23-19-7-5-17(6-8-19)20-4-2-1-3-13-27(20)22(28)18-9-14-26(15-10-18)21-16-24-11-12-25-21/h5-8,11-12,16,18,20H,1-4,9-10,13-15H2 |
| InChIKey | QBUKGQUHASZJLZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |