C18H17F3N2O3S — CID 43069416
2,3,4-trifluoro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzenesulfonamide (PubChem CID 43069416) has the molecular formula C18H17F3N2O3S and a molecular weight of 398.41 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43069416 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cccc(C(=O)N2CCCC2)c1NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17F3N2O3S/c1-11-5-4-6-12(18(24)23-9-2-3-10-23)17(11)22-27(25,26)14-8-7-13(19)15(20)16(14)21/h4-8,22H,2-3,9-10H2,1H3 |
| InChIKey | IVGHWDPQPVGJJU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|