C19H18Cl2N2O2 — CID 55643315
2,5-dichloro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 55643315) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55643315 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2,5-dichloro-N-[2-methyl-6-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)N2CCCC2)c1NC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-12-5-4-6-14(19(25)23-9-2-3-10-23)17(12)22-18(24)15-11-13(20)7-8-16(15)21/h4-8,11H,2-3,9-10H2,1H3,(H,22,24) |
| InChIKey | RZFGRMFBRZYQPV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |