C16H16BrFN2O4 — CID 43071322
2-(4-bromo-2-fluorophenoxy)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide (PubChem CID 43071322) has the molecular formula C16H16BrFN2O4 and a molecular weight of 399.22 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 43071322 |
| Molecular Formula | C16H16BrFN2O4 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-[6-(2-methoxyethoxy)-3-pyridinyl]acetamide |
| SMILES | COCCOc1ccc(NC(=O)COc2ccc(Br)cc2F)cn1 |
| InChI | InChI=1S/C16H16BrFN2O4/c1-22-6-7-23-16-5-3-12(9-19-16)20-15(21)10-24-14-4-2-11(17)8-13(14)18/h2-5,8-9H,6-7,10H2,1H3,(H,20,21) |
| InChIKey | YDMXFEUYXOYMPB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|