C23H25N5O2 — CID 43073880
N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 43073880) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43073880 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(NCCNC(=O)C2CCN(C(=O)/C=C/c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C23H25N5O2/c24-16-19-6-8-21(27-17-19)25-12-13-26-23(30)20-10-14-28(15-11-20)22(29)9-7-18-4-2-1-3-5-18/h1-9,17,20H,10-15H2,(H,25,27)(H,26,30)/b9-7+ |
| InChIKey | RFDPHMDCIIKRAU-VQHVLOKHSA-N |
| XLogP | 2.43 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|