C17H23N3O — CID 43074025
N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-3,3-dimethylbutanamide (PubChem CID 43074025) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 43074025 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(C)n(-c2ccccc2NC(=O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C17H23N3O/c1-12-10-13(2)20(19-12)15-9-7-6-8-14(15)18-16(21)11-17(3,4)5/h6-10H,11H2,1-5H3,(H,18,21) |
| InChIKey | ZCAOJAHDRIQFFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |