C19H19N3O2 — CID 52847994
N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(2-hydroxyphenyl)acetamide (PubChem CID 52847994) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 52847994 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-2-(2-hydroxyphenyl)acetamide |
| SMILES | Cc1cc(C)n(-c2ccccc2NC(=O)Cc2ccccc2O)n1 |
| InChI | InChI=1S/C19H19N3O2/c1-13-11-14(2)22(21-13)17-9-5-4-8-16(17)20-19(24)12-15-7-3-6-10-18(15)23/h3-11,23H,12H2,1-2H3,(H,20,24) |
| InChIKey | NNOSXSXPYBQXIR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |