C20H16Cl2N4O2 — CID 43075119
N-[(E)-(6,8-dichloro-2H-chromen-3-yl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 43075119) has the molecular formula C20H16Cl2N4O2 and a molecular weight of 415.28 g/mol. Its IUPAC name is N-[(E)-(6,8-dichloro-2H-chromen-3-yl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(E)-(6,8-dichloro-2H-chromen-3-yl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 43075119 |
| Molecular Formula | C20H16Cl2N4O2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[(E)-(6,8-dichloro-2H-chromen-3-yl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | Cc1nc2ccccc2n1CC(=O)N/N=C/C1=Cc2cc(Cl)cc(Cl)c2OC1 |
| InChI | InChI=1S/C20H16Cl2N4O2/c1-12-24-17-4-2-3-5-18(17)26(12)10-19(27)25-23-9-13-6-14-7-15(21)8-16(22)20(14)28-11-13/h2-9H,10-11H2,1H3,(H,25,27)/b23-9+ |
| InChIKey | HFFHVNGMSADCPJ-NUGSKGIGSA-N |
| XLogP | 4.23 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|