C18H27N3O3S — CID 43076539
1-(3-ethoxypropyl)-3-[4-(2-morpholin-4-yl-2-oxoethyl)phenyl]thiourea (PubChem CID 43076539) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[4-(2-morpholin-4-yl-2-oxoethyl)phenyl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[4-(2-morpholin-4-yl-2-oxoethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 43076539 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[4-(2-morpholin-4-yl-2-oxoethyl)phenyl]thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccc(CC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O3S/c1-2-23-11-3-8-19-18(25)20-16-6-4-15(5-7-16)14-17(22)21-9-12-24-13-10-21/h4-7H,2-3,8-14H2,1H3,(H2,19,20,25) |
| InChIKey | QNTYSMALNNUQBY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|