C18H27N3O2S — CID 60611963
1-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-3-pentylurea (PubChem CID 60611963) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-3-pentylurea.
| Compound Name | 1-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 60611963 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1ccc(CC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-2-3-4-9-19-18(23)20-16-7-5-15(6-8-16)14-17(22)21-10-12-24-13-11-21/h5-8H,2-4,9-14H2,1H3,(H2,19,20,23) |
| InChIKey | VBRLOZXCCPASFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|