C20H29N3O2S — CID 60611862
1-(cyclohexylmethyl)-3-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]urea (PubChem CID 60611862) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]urea.
| Compound Name | 1-(cyclohexylmethyl)-3-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]urea |
|---|---|
| PubChem CID | 60611862 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]urea |
| SMILES | O=C(NCC1CCCCC1)Nc1ccc(CC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c24-19(23-10-12-26-13-11-23)14-16-6-8-18(9-7-16)22-20(25)21-15-17-4-2-1-3-5-17/h6-9,17H,1-5,10-15H2,(H2,21,22,25) |
| InChIKey | VATODNPQYIICCV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |