C17H15ClINO2 — CID 43077937
4-chloro-N-(3,4-dihydro-2H-chromen-3-ylmethyl)-2-iodobenzamide (PubChem CID 43077937) has the molecular formula C17H15ClINO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dihydro-2H-chromen-3-ylmethyl)-2-iodobenzamide.
| Compound Name | 4-chloro-N-(3,4-dihydro-2H-chromen-3-ylmethyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 43077937 |
| Molecular Formula | C17H15ClINO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | 4-chloro-N-(3,4-dihydro-2H-chromen-3-ylmethyl)-2-iodobenzamide |
| SMILES | O=C(NCC1COc2ccccc2C1)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C17H15ClINO2/c18-13-5-6-14(15(19)8-13)17(21)20-9-11-7-12-3-1-2-4-16(12)22-10-11/h1-6,8,11H,7,9-10H2,(H,20,21) |
| InChIKey | QHMHRQZKPHCNAV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|