C17H20FN — CID 43078764
N-[(4-ethylphenyl)methyl]-1-(4-fluorophenyl)ethanamine (PubChem CID 43078764) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[(4-ethylphenyl)methyl]-1-(4-fluorophenyl)ethanamine.
| Compound Name | N-[(4-ethylphenyl)methyl]-1-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 43078764 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(4-ethylphenyl)methyl]-1-(4-fluorophenyl)ethanamine |
| SMILES | CCc1ccc(CNC(C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H20FN/c1-3-14-4-6-15(7-5-14)12-19-13(2)16-8-10-17(18)11-9-16/h4-11,13,19H,3,12H2,1-2H3 |
| InChIKey | CEYANCBGIFAWKZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |