C18H24FNSi — CID 103437945
(1R)-1-(4-fluorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103437945) has the molecular formula C18H24FNSi and a molecular weight of 301.48 g/mol. Its IUPAC name is (1R)-1-(4-fluorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(4-fluorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103437945 |
| Molecular Formula | C18H24FNSi |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1R)-1-(4-fluorophenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc([Si](C)(C)C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNSi/c1-14(16-7-9-17(19)10-8-16)20-13-15-5-11-18(12-6-15)21(2,3)4/h5-12,14,20H,13H2,1-4H3/t14-/m1/s1 |
| InChIKey | MHRNBUMMWZXBGI-CQSZACIVSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|