C19H27NSi — CID 103437947
(1R)-1-(4-methylphenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103437947) has the molecular formula C19H27NSi and a molecular weight of 297.52 g/mol. Its IUPAC name is (1R)-1-(4-methylphenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(4-methylphenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103437947 |
| Molecular Formula | C19H27NSi |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1R)-1-(4-methylphenyl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | Cc1ccc([C@@H](C)NCc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H27NSi/c1-15-6-10-18(11-7-15)16(2)20-14-17-8-12-19(13-9-17)21(3,4)5/h6-13,16,20H,14H2,1-5H3/t16-/m1/s1 |
| InChIKey | QYTFIVULLVGZCW-MRXNPFEDSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|