C11H12N2O5S — CID 43080450
2-[(2-cyanophenyl)methylsulfonylamino]-3-hydroxypropanoic acid (PubChem CID 43080450) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)methylsulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2-cyanophenyl)methylsulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 43080450 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-[(2-cyanophenyl)methylsulfonylamino]-3-hydroxypropanoic acid |
| SMILES | N#Cc1ccccc1CS(=O)(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C11H12N2O5S/c12-5-8-3-1-2-4-9(8)7-19(17,18)13-10(6-14)11(15)16/h1-4,10,13-14H,6-7H2,(H,15,16) |
| InChIKey | LCVCCKIOVFSSPQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |