C15H12N2O5S — CID 45330184
4-[(2-cyanophenyl)methylsulfonylamino]-2-hydroxybenzoic acid (PubChem CID 45330184) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is 4-[(2-cyanophenyl)methylsulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(2-cyanophenyl)methylsulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 45330184 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-[(2-cyanophenyl)methylsulfonylamino]-2-hydroxybenzoic acid |
| SMILES | N#Cc1ccccc1CS(=O)(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C15H12N2O5S/c16-8-10-3-1-2-4-11(10)9-23(21,22)17-12-5-6-13(15(19)20)14(18)7-12/h1-7,17-18H,9H2,(H,19,20) |
| InChIKey | GGDBZHOHGYCLMS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |