C29H23N3O9S2 — CID 123377503
2-[4-(benzylsulfonylamino)-2-hydroxybenzoyl]oxy-4-[(2-cyanophenyl)methylsulfonylamino]benzoic acid (PubChem CID 123377503) has the molecular formula C29H23N3O9S2 and a molecular weight of 621.65 g/mol. Its IUPAC name is 2-[4-(benzylsulfonylamino)-2-hydroxybenzoyl]oxy-4-[(2-cyanophenyl)methylsulfonylamino]benzoic acid.
| Compound Name | 2-[4-(benzylsulfonylamino)-2-hydroxybenzoyl]oxy-4-[(2-cyanophenyl)methylsulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 123377503 |
| Molecular Formula | C29H23N3O9S2 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | 2-[4-(benzylsulfonylamino)-2-hydroxybenzoyl]oxy-4-[(2-cyanophenyl)methylsulfonylamino]benzoic acid |
| SMILES | N#Cc1ccccc1CS(=O)(=O)Nc1ccc(C(=O)O)c(OC(=O)c2ccc(NS(=O)(=O)Cc3ccccc3)cc2O)c1 |
| InChI | InChI=1S/C29H23N3O9S2/c30-16-20-8-4-5-9-21(20)18-43(39,40)32-23-11-13-25(28(34)35)27(15-23)41-29(36)24-12-10-22(14-26(24)33)31-42(37,38)17-19-6-2-1-3-7-19/h1-15,31-33H,17-18H2,(H,34,35) |
| InChIKey | LJYCBRIQSLBSRY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 199.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|