C17H16N2O5S — CID 51119332
N-[(2-cyanophenyl)methylsulfonyl]-2,4-dimethoxybenzamide (PubChem CID 51119332) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[(2-cyanophenyl)methylsulfonyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[(2-cyanophenyl)methylsulfonyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51119332 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[(2-cyanophenyl)methylsulfonyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NS(=O)(=O)Cc2ccccc2C#N)c(OC)c1 |
| InChI | InChI=1S/C17H16N2O5S/c1-23-14-7-8-15(16(9-14)24-2)17(20)19-25(21,22)11-13-6-4-3-5-12(13)10-18/h3-9H,11H2,1-2H3,(H,19,20) |
| InChIKey | BLRLYQLJVLEJOV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |