C11H14FNO2 — CID 43087255
3-[1-(4-fluorophenyl)ethylamino]propanoic acid (PubChem CID 43087255) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)ethylamino]propanoic acid.
| Compound Name | 3-[1-(4-fluorophenyl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 43087255 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-[1-(4-fluorophenyl)ethylamino]propanoic acid |
| SMILES | CC(NCCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2/c1-8(13-7-6-11(14)15)9-2-4-10(12)5-3-9/h2-5,8,13H,6-7H2,1H3,(H,14,15) |
| InChIKey | BOSOXMFEYDGDJF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |