3-[1-(4-fluorophenyl)ethylamino]propanoic acid

C11H14FNO2 — CID 43087255

IUPAC3-[1-(4-fluorophenyl)ethylamino]propanoic acid
SMILESCC(NCCC(=O)O)c1ccc(F)cc1
InChIInChI=1S/C11H14FNO2/c1-8(13-7-6-11(14)15)9-2-4-10(12)5-3-9/h2-5,8,13H,6-7H2,1H3,(H,14,15)
InChIKeyBOSOXMFEYDGDJF-UHFFFAOYSA-N
MW211.24 g/mol
LogP1.95
Rot. Bonds5

About 3-[1-(4-fluorophenyl)ethylamino]propanoic acid

3-[1-(4-fluorophenyl)ethylamino]propanoic acid (PubChem CID 43087255) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)ethylamino]propanoic acid.

Molecular Properties

Compound Name3-[1-(4-fluorophenyl)ethylamino]propanoic acid
PubChem CID43087255
Molecular FormulaC11H14FNO2
Molecular Weight211.24 g/mol
Exact Mass211.10
IUPAC Name3-[1-(4-fluorophenyl)ethylamino]propanoic acid
SMILESCC(NCCC(=O)O)c1ccc(F)cc1
InChIInChI=1S/C11H14FNO2/c1-8(13-7-6-11(14)15)9-2-4-10(12)5-3-9/h2-5,8,13H,6-7H2,1H3,(H,14,15)
InChIKeyBOSOXMFEYDGDJF-UHFFFAOYSA-N
XLogP1.95
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.24
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[1-(4-fluorophenyl)ethylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(1-phenylethylamino)propanoic acid
CID 2826777
3-[[(1S)-1-(4-chlorophenyl)ethyl]amino]propanoic acid
CID 81352269
3-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-N,N-dimethylpropanamide
CID 81348231
N-ethyl-3-[[(1S)-1-(4-fluorophenyl)ethyl]amino]propanamide
CID 81347490
3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]propanoic acid
CID 81371134
ethyl 3-[[(1R)-1-(4-fluorophenyl)ethyl]amino]propanoate
CID 81348224
N-[1-(4-fluorophenyl)ethyl]-3-methylbut-3-en-1-amine
CID 114449108
3-[1-(4-pyridin-4-ylphenyl)ethylamino]propanoic acid
CID 139017053
3-[1-(4-ethoxyphenyl)ethylamino]propanoic acid
CID 43088463
6-[1-(4-fluorophenyl)ethylamino]-6-oxohexanoic acid
CID 54867660
5-[1-(4-fluorophenyl)ethylamino]-5-oxopentanoic acid
CID 60662109
4-[[(1R)-1-(3-fluorophenyl)ethyl]amino]butanoic acid
CID 81365721

Frequently Asked Questions

What is the IUPAC name of 3-[1-(4-fluorophenyl)ethylamino]propanoic acid?
The IUPAC name of 3-[1-(4-fluorophenyl)ethylamino]propanoic acid (CID 43087255) is 3-[1-(4-fluorophenyl)ethylamino]propanoic acid.
What is the SMILES notation for 3-[1-(4-fluorophenyl)ethylamino]propanoic acid?
The canonical SMILES for 3-[1-(4-fluorophenyl)ethylamino]propanoic acid is CC(NCCC(=O)O)c1ccc(F)cc1.
What is the InChIKey of 3-[1-(4-fluorophenyl)ethylamino]propanoic acid?
The InChIKey is BOSOXMFEYDGDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO2/c1-8(13-7-6-11(14)15)9-2-4-10(12)5-3-9/h2-5,8,13H,6-7H2,1H3,(H,14,15).
What are the key properties of 3-[1-(4-fluorophenyl)ethylamino]propanoic acid?
3-[1-(4-fluorophenyl)ethylamino]propanoic acid has a molecular weight of 211.24 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-fluorophenyl)ethylamino]propanoic acid is sourced from PubChem (CID 43087255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).