C14H26N2O — CID 43087479
2-[(2,3-dimethylcyclohexyl)amino]-N-prop-2-enylpropanamide (PubChem CID 43087479) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclohexyl)amino]-N-prop-2-enylpropanamide.
| Compound Name | 2-[(2,3-dimethylcyclohexyl)amino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 43087479 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-[(2,3-dimethylcyclohexyl)amino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NC1CCCC(C)C1C |
| InChI | InChI=1S/C14H26N2O/c1-5-9-15-14(17)12(4)16-13-8-6-7-10(2)11(13)3/h5,10-13,16H,1,6-9H2,2-4H3,(H,15,17) |
| InChIKey | GHQRALHIGWVOGY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|