C13H24N2O — CID 78908844
N-(2,3-dimethylcyclohexyl)-2-(prop-2-enylamino)acetamide (PubChem CID 78908844) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 78908844 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NC1CCCC(C)C1C |
| InChI | InChI=1S/C13H24N2O/c1-4-8-14-9-13(16)15-12-7-5-6-10(2)11(12)3/h4,10-12,14H,1,5-9H2,2-3H3,(H,15,16) |
| InChIKey | HEJXJGQZAINFAE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|