C13H18N4O2S — CID 43091245
N,3,5-trimethyl-N-(2-pyridin-2-ylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 43091245) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N,3,5-trimethyl-N-(2-pyridin-2-ylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N,3,5-trimethyl-N-(2-pyridin-2-ylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 43091245 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N,3,5-trimethyl-N-(2-pyridin-2-ylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C13H18N4O2S/c1-10-13(11(2)16-15-10)20(18,19)17(3)9-7-12-6-4-5-8-14-12/h4-6,8H,7,9H2,1-3H3,(H,15,16) |
| InChIKey | QHUVTNQLHSHMRI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |