C9H10N2OS — CID 43091275
2,3-dihydro-1-benzothiophene-2-carbohydrazide (PubChem CID 43091275) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | 2,3-dihydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 43091275 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2,3-dihydro-1-benzothiophene-2-carbohydrazide |
| SMILES | NNC(=O)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C9H10N2OS/c10-11-9(12)8-5-6-3-1-2-4-7(6)13-8/h1-4,8H,5,10H2,(H,11,12) |
| InChIKey | HBIDPMHKVYYSJD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|