C15H19FN2O2S — CID 7969898
2-cyclopentyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide (PubChem CID 7969898) has the molecular formula C15H19FN2O2S and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-cyclopentyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide.
| Compound Name | 2-cyclopentyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide |
|---|---|
| PubChem CID | 7969898 |
| Molecular Formula | C15H19FN2O2S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-cyclopentyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]acetohydrazide |
| SMILES | O=C(CSc1ccccc1F)NNC(=O)CC1CCCC1 |
| InChI | InChI=1S/C15H19FN2O2S/c16-12-7-3-4-8-13(12)21-10-15(20)18-17-14(19)9-11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | LTZXOOXCKSAUIA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|