C23H22N2O9 — CID 4310040
methyl 4-[1-[2-(2-hydroxyethoxy)ethyl]-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 4310040) has the molecular formula C23H22N2O9 and a molecular weight of 470.43 g/mol. Its IUPAC name is methyl 4-[1-[2-(2-hydroxyethoxy)ethyl]-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-[2-(2-hydroxyethoxy)ethyl]-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 4310040 |
| Molecular Formula | C23H22N2O9 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | methyl 4-[1-[2-(2-hydroxyethoxy)ethyl]-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3cccc([N+](=O)[O-])c3)C(=O)C(=O)N2CCOCCO)cc1 |
| InChI | InChI=1S/C23H22N2O9/c1-33-23(30)15-7-5-14(6-8-15)19-18(20(27)16-3-2-4-17(13-16)25(31)32)21(28)22(29)24(19)9-11-34-12-10-26/h2-8,13,19,26-27H,9-12H2,1H3 |
| InChIKey | ZBVHBKLYFFVHRP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|