C21H18Cl2N2O7 — CID 3821524
5-(2,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 3821524) has the molecular formula C21H18Cl2N2O7 and a molecular weight of 481.29 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3821524 |
| Molecular Formula | C21H18Cl2N2O7 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethyl]-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCOCCO)C(c2ccc(Cl)cc2Cl)C1=C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18Cl2N2O7/c22-13-4-5-15(16(23)11-13)18-17(19(27)12-2-1-3-14(10-12)25(30)31)20(28)21(29)24(18)6-8-32-9-7-26/h1-5,10-11,18,26-27H,6-9H2 |
| InChIKey | DSQGHUTZXLBZTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|