C23H20Cl2N2O7 — CID 92849006
6-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 92849006) has the molecular formula C23H20Cl2N2O7 and a molecular weight of 507.33 g/mol. Its IUPAC name is 6-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 92849006 |
| Molecular Formula | C23H20Cl2N2O7 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 6-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(=O)C(=C(O)c2ccc([N+](=O)[O-])cc2)[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O7/c24-14-7-10-16(17(25)12-14)20-19(21(30)13-5-8-15(9-6-13)27(33)34)22(31)23(32)26(20)11-3-1-2-4-18(28)29/h5-10,12,20,30H,1-4,11H2,(H,28,29)/t20-/m0/s1 |
| InChIKey | SIBVCVBFWSOZPE-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|