C17H21BrN2 — CID 43104509
1-(3-bromophenyl)-N-ethyl-N-(2-methylphenyl)ethane-1,2-diamine (PubChem CID 43104509) has the molecular formula C17H21BrN2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-ethyl-N-(2-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(3-bromophenyl)-N-ethyl-N-(2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43104509 |
| Molecular Formula | C17H21BrN2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-(3-bromophenyl)-N-ethyl-N-(2-methylphenyl)ethane-1,2-diamine |
| SMILES | CCN(c1ccccc1C)C(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H21BrN2/c1-3-20(16-10-5-4-7-13(16)2)17(12-19)14-8-6-9-15(18)11-14/h4-11,17H,3,12,19H2,1-2H3 |
| InChIKey | DFIFOARIPIBUIQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |