C14H22BrN — CID 82929806
2-(3-bromophenyl)-4-ethylhexan-1-amine (PubChem CID 82929806) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-ethylhexan-1-amine.
| Compound Name | 2-(3-bromophenyl)-4-ethylhexan-1-amine |
|---|---|
| PubChem CID | 82929806 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-(3-bromophenyl)-4-ethylhexan-1-amine |
| SMILES | CCC(CC)CC(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-3-11(4-2)8-13(10-16)12-6-5-7-14(15)9-12/h5-7,9,11,13H,3-4,8,10,16H2,1-2H3 |
| InChIKey | NUOHFDWMWQGUEE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |