C13H20BrNO — CID 79442547
2-(3-bromophenyl)-5-ethoxypentan-1-amine (PubChem CID 79442547) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-ethoxypentan-1-amine.
| Compound Name | 2-(3-bromophenyl)-5-ethoxypentan-1-amine |
|---|---|
| PubChem CID | 79442547 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(3-bromophenyl)-5-ethoxypentan-1-amine |
| SMILES | CCOCCCC(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrNO/c1-2-16-8-4-6-12(10-15)11-5-3-7-13(14)9-11/h3,5,7,9,12H,2,4,6,8,10,15H2,1H3 |
| InChIKey | JXZJYHORHOHRGS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|