C16H18ClNO3 — CID 43105239
2-[1-(4-chloro-2,5-dimethoxyanilino)ethyl]phenol (PubChem CID 43105239) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-[1-(4-chloro-2,5-dimethoxyanilino)ethyl]phenol.
| Compound Name | 2-[1-(4-chloro-2,5-dimethoxyanilino)ethyl]phenol |
|---|---|
| PubChem CID | 43105239 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[1-(4-chloro-2,5-dimethoxyanilino)ethyl]phenol |
| SMILES | COc1cc(NC(C)c2ccccc2O)c(OC)cc1Cl |
| InChI | InChI=1S/C16H18ClNO3/c1-10(11-6-4-5-7-14(11)19)18-13-9-15(20-2)12(17)8-16(13)21-3/h4-10,18-19H,1-3H3 |
| InChIKey | GOYDPWINDLGJFO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|