C19H26N2 — CID 43108017
4-[[1-(2,4-dimethylphenyl)ethylamino]methyl]-N,N-dimethylaniline (PubChem CID 43108017) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-[[1-(2,4-dimethylphenyl)ethylamino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(2,4-dimethylphenyl)ethylamino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 43108017 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-[[1-(2,4-dimethylphenyl)ethylamino]methyl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(C(C)NCc2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C19H26N2/c1-14-6-11-19(15(2)12-14)16(3)20-13-17-7-9-18(10-8-17)21(4)5/h6-12,16,20H,13H2,1-5H3 |
| InChIKey | KEICZNMVCDVUDL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|