C17H24N4 — CID 22662329
2-[1-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzene-1,4-diamine (PubChem CID 22662329) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-[1-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzene-1,4-diamine.
| Compound Name | 2-[1-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 22662329 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-[1-[[4-(dimethylamino)phenyl]methylamino]ethyl]benzene-1,4-diamine |
| SMILES | CC(NCc1ccc(N(C)C)cc1)c1cc(N)ccc1N |
| InChI | InChI=1S/C17H24N4/c1-12(16-10-14(18)6-9-17(16)19)20-11-13-4-7-15(8-5-13)21(2)3/h4-10,12,20H,11,18-19H2,1-3H3 |
| InChIKey | TZHIISNKWOHTPM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|