C18H31NO2 — CID 43111176
N-[1-(3,4-dimethoxyphenyl)ethyl]-6-methylheptan-2-amine (PubChem CID 43111176) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-6-methylheptan-2-amine.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 43111176 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-6-methylheptan-2-amine |
| SMILES | COc1ccc(C(C)NC(C)CCCC(C)C)cc1OC |
| InChI | InChI=1S/C18H31NO2/c1-13(2)8-7-9-14(3)19-15(4)16-10-11-17(20-5)18(12-16)21-6/h10-15,19H,7-9H2,1-6H3 |
| InChIKey | HDRSCNCHLCBPJD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |