C13H16F2N2O — CID 43114983
4-[4-(difluoromethoxy)phenyl]-2-methyl-2-(methylamino)butanenitrile (PubChem CID 43114983) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-2-methyl-2-(methylamino)butanenitrile.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-2-methyl-2-(methylamino)butanenitrile |
|---|---|
| PubChem CID | 43114983 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-2-methyl-2-(methylamino)butanenitrile |
| SMILES | CNC(C)(C#N)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H16F2N2O/c1-13(9-16,17-2)8-7-10-3-5-11(6-4-10)18-12(14)15/h3-6,12,17H,7-8H2,1-2H3 |
| InChIKey | QTKCFOPXLXKKEC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |