C14H21F2NO2 — CID 65234748
5-[4-(difluoromethoxy)phenyl]-3-methyl-3-(methylamino)pentan-1-ol (PubChem CID 65234748) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-3-methyl-3-(methylamino)pentan-1-ol.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-3-methyl-3-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 65234748 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-3-methyl-3-(methylamino)pentan-1-ol |
| SMILES | CNC(C)(CCO)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H21F2NO2/c1-14(17-2,9-10-18)8-7-11-3-5-12(6-4-11)19-13(15)16/h3-6,13,17-18H,7-10H2,1-2H3 |
| InChIKey | BTJTXJCCMPEGPJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |