C15H24F2N2O2 — CID 62542388
4-[4-(difluoromethoxy)phenyl]-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine (PubChem CID 62542388) has the molecular formula C15H24F2N2O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62542388 |
| Molecular Formula | C15H24F2N2O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-2-N-(2-methoxyethyl)-2-methylbutane-1,2-diamine |
| SMILES | COCCNC(C)(CN)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H24F2N2O2/c1-15(11-18,19-9-10-20-2)8-7-12-3-5-13(6-4-12)21-14(16)17/h3-6,14,19H,7-11,18H2,1-2H3 |
| InChIKey | YCXOFUYZJUFIOI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|