C11H14BrFN2O — CID 43119470
2-(2-bromo-4-fluoroanilino)-N-ethylpropanamide (PubChem CID 43119470) has the molecular formula C11H14BrFN2O and a molecular weight of 289.15 g/mol. Its IUPAC name is 2-(2-bromo-4-fluoroanilino)-N-ethylpropanamide.
| Compound Name | 2-(2-bromo-4-fluoroanilino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 43119470 |
| Molecular Formula | C11H14BrFN2O |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(2-bromo-4-fluoroanilino)-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C11H14BrFN2O/c1-3-14-11(16)7(2)15-10-5-4-8(13)6-9(10)12/h4-7,15H,3H2,1-2H3,(H,14,16) |
| InChIKey | YRNMZDLDLBMIMU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |