C16H20N2O3 — CID 43121506
2-pyridin-2-yl-1-(2,4,5-trimethoxyphenyl)ethanamine (PubChem CID 43121506) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-pyridin-2-yl-1-(2,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | 2-pyridin-2-yl-1-(2,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 43121506 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-pyridin-2-yl-1-(2,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(OC)c(C(N)Cc2ccccn2)cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-19-14-10-16(21-3)15(20-2)9-12(14)13(17)8-11-6-4-5-7-18-11/h4-7,9-10,13H,8,17H2,1-3H3 |
| InChIKey | VZKGNOURRKKCHY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |