C16H15F2N3 — CID 43123935
2,6-difluoro-N-[1-(1-methylbenzimidazol-2-yl)ethyl]aniline (PubChem CID 43123935) has the molecular formula C16H15F2N3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2,6-difluoro-N-[1-(1-methylbenzimidazol-2-yl)ethyl]aniline.
| Compound Name | 2,6-difluoro-N-[1-(1-methylbenzimidazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43123935 |
| Molecular Formula | C16H15F2N3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2,6-difluoro-N-[1-(1-methylbenzimidazol-2-yl)ethyl]aniline |
| SMILES | CC(Nc1c(F)cccc1F)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H15F2N3/c1-10(19-15-11(17)6-5-7-12(15)18)16-20-13-8-3-4-9-14(13)21(16)2/h3-10,19H,1-2H3 |
| InChIKey | DYVFVLKNIJTAJH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |