C16H14Br2N2 — CID 43126206
4-[1-(2,6-dibromo-4-methylanilino)ethyl]benzonitrile (PubChem CID 43126206) has the molecular formula C16H14Br2N2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 4-[1-(2,6-dibromo-4-methylanilino)ethyl]benzonitrile.
| Compound Name | 4-[1-(2,6-dibromo-4-methylanilino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 43126206 |
| Molecular Formula | C16H14Br2N2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 4-[1-(2,6-dibromo-4-methylanilino)ethyl]benzonitrile |
| SMILES | Cc1cc(Br)c(NC(C)c2ccc(C#N)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2/c1-10-7-14(17)16(15(18)8-10)20-11(2)13-5-3-12(9-19)4-6-13/h3-8,11,20H,1-2H3 |
| InChIKey | OODHSUCMJKYZEO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |