C16H14F2N2 — CID 82818775
4-[1-(2,6-difluoro-3-methylanilino)ethyl]benzonitrile (PubChem CID 82818775) has the molecular formula C16H14F2N2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-[1-(2,6-difluoro-3-methylanilino)ethyl]benzonitrile.
| Compound Name | 4-[1-(2,6-difluoro-3-methylanilino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 82818775 |
| Molecular Formula | C16H14F2N2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-[1-(2,6-difluoro-3-methylanilino)ethyl]benzonitrile |
| SMILES | Cc1ccc(F)c(NC(C)c2ccc(C#N)cc2)c1F |
| InChI | InChI=1S/C16H14F2N2/c1-10-3-8-14(17)16(15(10)18)20-11(2)13-6-4-12(9-19)5-7-13/h3-8,11,20H,1-2H3 |
| InChIKey | MWYDYDZGZLSINP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |