C15H25NO3 — CID 43127780
1-(3,4-dimethoxyphenyl)-2-(2-methylbutan-2-yloxy)ethanamine (PubChem CID 43127780) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(2-methylbutan-2-yloxy)ethanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(2-methylbutan-2-yloxy)ethanamine |
|---|---|
| PubChem CID | 43127780 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(2-methylbutan-2-yloxy)ethanamine |
| SMILES | CCC(C)(C)OCC(N)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H25NO3/c1-6-15(2,3)19-10-12(16)11-7-8-13(17-4)14(9-11)18-5/h7-9,12H,6,10,16H2,1-5H3 |
| InChIKey | HYTZMIOEUFAJEK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |