C8H12N2O3 — CID 43131896
1-(3-methylbutyl)imidazolidine-2,4,5-trione (PubChem CID 43131896) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(3-methylbutyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(3-methylbutyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 43131896 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(3-methylbutyl)imidazolidine-2,4,5-trione |
| SMILES | CC(C)CCN1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C8H12N2O3/c1-5(2)3-4-10-7(12)6(11)9-8(10)13/h5H,3-4H2,1-2H3,(H,9,11,13) |
| InChIKey | DQFNWNZRDWMTCK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|