C14H20FN3O2 — CID 43133174
3-fluoro-N'-hydroxy-4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 43133174) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 43133174 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[4-(hydroxymethyl)piperidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(CN2CCC(CO)CC2)c(F)c1 |
| InChI | InChI=1S/C14H20FN3O2/c15-13-7-11(14(16)17-20)1-2-12(13)8-18-5-3-10(9-19)4-6-18/h1-2,7,10,19-20H,3-6,8-9H2,(H2,16,17) |
| InChIKey | OXILKGQCJLJHLL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|