C12H18FN3O2 — CID 165399365
3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide (PubChem CID 165399365) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 165399365 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide |
| SMILES | CN(CCCO)Cc1ccc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C12H18FN3O2/c1-16(5-2-6-17)8-10-4-3-9(7-11(10)13)12(14)15-18/h3-4,7,17-18H,2,5-6,8H2,1H3,(H2,14,15) |
| InChIKey | CLFCWHNXHLDBKI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|