C15H23F2N3O2 — CID 91169954
3,5-difluoro-N'-hydroxy-4-[[methyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]methyl]benzenecarboximidamide (PubChem CID 91169954) has the molecular formula C15H23F2N3O2 and a molecular weight of 315.36 g/mol. Its IUPAC name is 3,5-difluoro-N'-hydroxy-4-[[methyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]methyl]benzenecarboximidamide.
| Compound Name | 3,5-difluoro-N'-hydroxy-4-[[methyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 91169954 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3,5-difluoro-N'-hydroxy-4-[[methyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]methyl]benzenecarboximidamide |
| SMILES | CN(CCOC(C)(C)C)Cc1c(F)cc(C(N)=NO)cc1F |
| InChI | InChI=1S/C15H23F2N3O2/c1-15(2,3)22-6-5-20(4)9-11-12(16)7-10(8-13(11)17)14(18)19-21/h7-8,21H,5-6,9H2,1-4H3,(H2,18,19) |
| InChIKey | ONLDSRMMQXXHTA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|