C17H26FN3O3 — CID 87091048
tert-butyl 2-[[2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl-methylamino]butanoate (PubChem CID 87091048) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is tert-butyl 2-[[2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl-methylamino]butanoate.
| Compound Name | tert-butyl 2-[[2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl-methylamino]butanoate |
|---|---|
| PubChem CID | 87091048 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl 2-[[2-fluoro-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]methyl-methylamino]butanoate |
| SMILES | CCC(C(=O)OC(C)(C)C)N(C)Cc1ccc(/C(N)=N\O)cc1F |
| InChI | InChI=1S/C17H26FN3O3/c1-6-14(16(22)24-17(2,3)4)21(5)10-12-8-7-11(9-13(12)18)15(19)20-23/h7-9,14,23H,6,10H2,1-5H3,(H2,19,20) |
| InChIKey | NIFFVFDNRWEWEC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|